C25H27ClN4O5 — CID 146479979
1-(3-chloro-4-methylphenyl)-3-[4-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]oxy]butyl]urea (PubChem CID 146479979) has the molecular formula C25H27ClN4O5 and a molecular weight of 498.97 g/mol. Its IUPAC name is 1-(3-chloro-4-methylphenyl)-3-[4-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]oxy]butyl]urea.
| Compound Name | 1-(3-chloro-4-methylphenyl)-3-[4-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]oxy]butyl]urea |
|---|---|
| PubChem CID | 146479979 |
| Molecular Formula | C25H27ClN4O5 |
| Molecular Weight | 498.97 g/mol |
| Exact Mass | 498.17 |
| IUPAC Name | 1-(3-chloro-4-methylphenyl)-3-[4-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]oxy]butyl]urea |
| SMILES | Cc1ccc(NC(=O)NCCCCOc2cccc3c2CN(C2CCC(=O)NC2=O)C3=O)cc1Cl |
| InChI | InChI=1S/C25H27ClN4O5/c1-15-7-8-16(13-19(15)26)28-25(34)27-11-2-3-12-35-21-6-4-5-17-18(21)14-30(24(17)33)20-9-10-22(31)29-23(20)32/h4-8,13,20H,2-3,9-12,14H2,1H3,(H2,27,28,34)(H,29,31,32) |
| InChIKey | DWEYDQIGSFFQQB-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.97 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|