C21H25N3O6 — CID 172692678
(2R)-1-[3-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]oxy]propyl]pyrrolidine-2-carboxylic acid (PubChem CID 172692678) has the molecular formula C21H25N3O6 and a molecular weight of 415.45 g/mol. Its IUPAC name is (2R)-1-[3-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]oxy]propyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2R)-1-[3-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]oxy]propyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 172692678 |
| Molecular Formula | C21H25N3O6 |
| Molecular Weight | 415.45 g/mol |
| Exact Mass | 415.17 |
| IUPAC Name | (2R)-1-[3-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]oxy]propyl]pyrrolidine-2-carboxylic acid |
| SMILES | O=C1CCC(N2Cc3c(OCCCN4CCC[C@@H]4C(=O)O)cccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C21H25N3O6/c25-18-8-7-15(19(26)22-18)24-12-14-13(20(24)27)4-1-6-17(14)30-11-3-10-23-9-2-5-16(23)21(28)29/h1,4,6,15-16H,2-3,5,7-12H2,(H,28,29)(H,22,25,26)/t15?,16-/m1/s1 |
| InChIKey | BWXZVIXXFGYITI-OEMAIJDKSA-N |
| XLogP | 0.77 |
| TPSA | 116.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.45 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|