C25H25N3O5 — CID 146480004
3-[7-[4-(2,3-dihydroindol-1-yl)-4-oxobutoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 146480004) has the molecular formula C25H25N3O5 and a molecular weight of 447.49 g/mol. Its IUPAC name is 3-[7-[4-(2,3-dihydroindol-1-yl)-4-oxobutoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[7-[4-(2,3-dihydroindol-1-yl)-4-oxobutoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 146480004 |
| Molecular Formula | C25H25N3O5 |
| Molecular Weight | 447.49 g/mol |
| Exact Mass | 447.18 |
| IUPAC Name | 3-[7-[4-(2,3-dihydroindol-1-yl)-4-oxobutoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3c(OCCCC(=O)N4CCc5ccccc54)cccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C25H25N3O5/c29-22-11-10-20(24(31)26-22)28-15-18-17(25(28)32)6-3-8-21(18)33-14-4-9-23(30)27-13-12-16-5-1-2-7-19(16)27/h1-3,5-8,20H,4,9-15H2,(H,26,29,31) |
| InChIKey | KSZYAYUNVSOPME-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.49 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|