C20H19ClN4O4S — CID 135291349
1-(3-chloro-4-methylphenyl)-3-[[5-(2,6-dioxopiperidin-3-yl)-6-oxo-4H-thieno[2,3-c]pyrrol-3-yl]methyl]urea (PubChem CID 135291349) has the molecular formula C20H19ClN4O4S and a molecular weight of 446.92 g/mol. Its IUPAC name is 1-(3-chloro-4-methylphenyl)-3-[[5-(2,6-dioxopiperidin-3-yl)-6-oxo-4H-thieno[2,3-c]pyrrol-3-yl]methyl]urea.
| Compound Name | 1-(3-chloro-4-methylphenyl)-3-[[5-(2,6-dioxopiperidin-3-yl)-6-oxo-4H-thieno[2,3-c]pyrrol-3-yl]methyl]urea |
|---|---|
| PubChem CID | 135291349 |
| Molecular Formula | C20H19ClN4O4S |
| Molecular Weight | 446.92 g/mol |
| Exact Mass | 446.08 |
| IUPAC Name | 1-(3-chloro-4-methylphenyl)-3-[[5-(2,6-dioxopiperidin-3-yl)-6-oxo-4H-thieno[2,3-c]pyrrol-3-yl]methyl]urea |
| SMILES | Cc1ccc(NC(=O)NCc2csc3c2CN(C2CCC(=O)NC2=O)C3=O)cc1Cl |
| InChI | InChI=1S/C20H19ClN4O4S/c1-10-2-3-12(6-14(10)21)23-20(29)22-7-11-9-30-17-13(11)8-25(19(17)28)15-4-5-16(26)24-18(15)27/h2-3,6,9,15H,4-5,7-8H2,1H3,(H2,22,23,29)(H,24,26,27) |
| InChIKey | UFFDPDWGCMIFOF-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.92 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|