C23H22ClN5O4 — CID 86344128
1-(3-chloro-4-methylphenyl)-3-[[3-[(3R)-2,6-dioxopiperidin-3-yl]-2-methyl-4-oxoquinazolin-6-yl]methyl]urea (PubChem CID 86344128) has the molecular formula C23H22ClN5O4 and a molecular weight of 467.91 g/mol. Its IUPAC name is 1-(3-chloro-4-methylphenyl)-3-[[3-[(3R)-2,6-dioxopiperidin-3-yl]-2-methyl-4-oxoquinazolin-6-yl]methyl]urea.
| Compound Name | 1-(3-chloro-4-methylphenyl)-3-[[3-[(3R)-2,6-dioxopiperidin-3-yl]-2-methyl-4-oxoquinazolin-6-yl]methyl]urea |
|---|---|
| PubChem CID | 86344128 |
| Molecular Formula | C23H22ClN5O4 |
| Molecular Weight | 467.91 g/mol |
| Exact Mass | 467.14 |
| IUPAC Name | 1-(3-chloro-4-methylphenyl)-3-[[3-[(3R)-2,6-dioxopiperidin-3-yl]-2-methyl-4-oxoquinazolin-6-yl]methyl]urea |
| SMILES | Cc1ccc(NC(=O)NCc2ccc3nc(C)n([C@@H]4CCC(=O)NC4=O)c(=O)c3c2)cc1Cl |
| InChI | InChI=1S/C23H22ClN5O4/c1-12-3-5-15(10-17(12)24)27-23(33)25-11-14-4-6-18-16(9-14)22(32)29(13(2)26-18)19-7-8-20(30)28-21(19)31/h3-6,9-10,19H,7-8,11H2,1-2H3,(H2,25,27,33)(H,28,30,31)/t19-/m1/s1 |
| InChIKey | HWMOUZJFQVXMBZ-LJQANCHMSA-N |
| XLogP | 2.97 |
| TPSA | 122.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.91 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|