C21H26N4O4 — CID 123383875
N-[3-(2,6-dioxopiperidin-3-yl)-2-methyl-4-oxoquinazolin-6-yl]heptanamide (PubChem CID 123383875) has the molecular formula C21H26N4O4 and a molecular weight of 398.46 g/mol. Its IUPAC name is N-[3-(2,6-dioxopiperidin-3-yl)-2-methyl-4-oxoquinazolin-6-yl]heptanamide.
| Compound Name | N-[3-(2,6-dioxopiperidin-3-yl)-2-methyl-4-oxoquinazolin-6-yl]heptanamide |
|---|---|
| PubChem CID | 123383875 |
| Molecular Formula | C21H26N4O4 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.20 |
| IUPAC Name | N-[3-(2,6-dioxopiperidin-3-yl)-2-methyl-4-oxoquinazolin-6-yl]heptanamide |
| SMILES | CCCCCCC(=O)Nc1ccc2nc(C)n(C3CCC(=O)NC3=O)c(=O)c2c1 |
| InChI | InChI=1S/C21H26N4O4/c1-3-4-5-6-7-18(26)23-14-8-9-16-15(12-14)21(29)25(13(2)22-16)17-10-11-19(27)24-20(17)28/h8-9,12,17H,3-7,10-11H2,1-2H3,(H,23,26)(H,24,27,28) |
| InChIKey | CPHCTWANEIGXCE-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 110.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|