C24H23ClN4O3 — CID 164563310
1-(3-chloro-4-methylphenyl)-3-[[3-(2,6-dioxopiperidin-3-yl)-2-methylquinolin-7-yl]methyl]urea (PubChem CID 164563310) has the molecular formula C24H23ClN4O3 and a molecular weight of 450.93 g/mol. Its IUPAC name is 1-(3-chloro-4-methylphenyl)-3-[[3-(2,6-dioxopiperidin-3-yl)-2-methylquinolin-7-yl]methyl]urea.
| Compound Name | 1-(3-chloro-4-methylphenyl)-3-[[3-(2,6-dioxopiperidin-3-yl)-2-methylquinolin-7-yl]methyl]urea |
|---|---|
| PubChem CID | 164563310 |
| Molecular Formula | C24H23ClN4O3 |
| Molecular Weight | 450.93 g/mol |
| Exact Mass | 450.15 |
| IUPAC Name | 1-(3-chloro-4-methylphenyl)-3-[[3-(2,6-dioxopiperidin-3-yl)-2-methylquinolin-7-yl]methyl]urea |
| SMILES | Cc1ccc(NC(=O)NCc2ccc3cc(C4CCC(=O)NC4=O)c(C)nc3c2)cc1Cl |
| InChI | InChI=1S/C24H23ClN4O3/c1-13-3-6-17(11-20(13)25)28-24(32)26-12-15-4-5-16-10-19(14(2)27-21(16)9-15)18-7-8-22(30)29-23(18)31/h3-6,9-11,18H,7-8,12H2,1-2H3,(H2,26,28,32)(H,29,30,31) |
| InChIKey | VGVWLKMYNOJMCC-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 100.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.93 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|