C22H22N6O4 — CID 151327500
1-(3,4-dimethylphenyl)-3-[[3-(2,6-dioxopiperidin-3-yl)-4-oxo-1,2,3-benzotriazin-7-yl]methyl]urea (PubChem CID 151327500) has the molecular formula C22H22N6O4 and a molecular weight of 434.46 g/mol. Its IUPAC name is 1-(3,4-dimethylphenyl)-3-[[3-(2,6-dioxopiperidin-3-yl)-4-oxo-1,2,3-benzotriazin-7-yl]methyl]urea.
| Compound Name | 1-(3,4-dimethylphenyl)-3-[[3-(2,6-dioxopiperidin-3-yl)-4-oxo-1,2,3-benzotriazin-7-yl]methyl]urea |
|---|---|
| PubChem CID | 151327500 |
| Molecular Formula | C22H22N6O4 |
| Molecular Weight | 434.46 g/mol |
| Exact Mass | 434.17 |
| IUPAC Name | 1-(3,4-dimethylphenyl)-3-[[3-(2,6-dioxopiperidin-3-yl)-4-oxo-1,2,3-benzotriazin-7-yl]methyl]urea |
| SMILES | Cc1ccc(NC(=O)NCc2ccc3c(=O)n(C4CCC(=O)NC4=O)nnc3c2)cc1C |
| InChI | InChI=1S/C22H22N6O4/c1-12-3-5-15(9-13(12)2)24-22(32)23-11-14-4-6-16-17(10-14)26-27-28(21(16)31)18-7-8-19(29)25-20(18)30/h3-6,9-10,18H,7-8,11H2,1-2H3,(H2,23,24,32)(H,25,29,30) |
| InChIKey | OHTFKIZXLQPKNM-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 135.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.46 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|