C28H27N5O4 — CID 90776785
1-[[2-(2,6-dioxopiperidin-3-yl)-1-hydroxyisoindol-5-yl]methyl]-3-[4-(2-pyridin-4-ylethyl)phenyl]urea (PubChem CID 90776785) has the molecular formula C28H27N5O4 and a molecular weight of 497.56 g/mol. Its IUPAC name is 1-[[2-(2,6-dioxopiperidin-3-yl)-1-hydroxyisoindol-5-yl]methyl]-3-[4-(2-pyridin-4-ylethyl)phenyl]urea.
| Compound Name | 1-[[2-(2,6-dioxopiperidin-3-yl)-1-hydroxyisoindol-5-yl]methyl]-3-[4-(2-pyridin-4-ylethyl)phenyl]urea |
|---|---|
| PubChem CID | 90776785 |
| Molecular Formula | C28H27N5O4 |
| Molecular Weight | 497.56 g/mol |
| Exact Mass | 497.21 |
| IUPAC Name | 1-[[2-(2,6-dioxopiperidin-3-yl)-1-hydroxyisoindol-5-yl]methyl]-3-[4-(2-pyridin-4-ylethyl)phenyl]urea |
| SMILES | O=C1CCC(n2cc3cc(CNC(=O)Nc4ccc(CCc5ccncc5)cc4)ccc3c2O)C(=O)N1 |
| InChI | InChI=1S/C28H27N5O4/c34-25-10-9-24(26(35)32-25)33-17-21-15-20(5-8-23(21)27(33)36)16-30-28(37)31-22-6-3-18(4-7-22)1-2-19-11-13-29-14-12-19/h3-8,11-15,17,24,36H,1-2,9-10,16H2,(H2,30,31,37)(H,32,34,35) |
| InChIKey | MMECFCWMQIVXHC-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 125.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.56 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|