C22H22N4O5 — CID 91101971
1-[[2-(2,6-dioxopiperidin-3-yl)-1-hydroxyisoindol-4-yl]methyl]-3-(4-methoxyphenyl)urea (PubChem CID 91101971) has the molecular formula C22H22N4O5 and a molecular weight of 422.44 g/mol. Its IUPAC name is 1-[[2-(2,6-dioxopiperidin-3-yl)-1-hydroxyisoindol-4-yl]methyl]-3-(4-methoxyphenyl)urea.
| Compound Name | 1-[[2-(2,6-dioxopiperidin-3-yl)-1-hydroxyisoindol-4-yl]methyl]-3-(4-methoxyphenyl)urea |
|---|---|
| PubChem CID | 91101971 |
| Molecular Formula | C22H22N4O5 |
| Molecular Weight | 422.44 g/mol |
| Exact Mass | 422.16 |
| IUPAC Name | 1-[[2-(2,6-dioxopiperidin-3-yl)-1-hydroxyisoindol-4-yl]methyl]-3-(4-methoxyphenyl)urea |
| SMILES | COc1ccc(NC(=O)NCc2cccc3c(O)n(C4CCC(=O)NC4=O)cc23)cc1 |
| InChI | InChI=1S/C22H22N4O5/c1-31-15-7-5-14(6-8-15)24-22(30)23-11-13-3-2-4-16-17(13)12-26(21(16)29)18-9-10-19(27)25-20(18)28/h2-8,12,18,29H,9-11H2,1H3,(H2,23,24,30)(H,25,27,28) |
| InChIKey | DODZMRKMEQIHIY-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 121.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.44 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|