C22H18ClF3N4O4 — CID 91391978
1-[3-chloro-4-(trifluoromethyl)phenyl]-3-[[2-(2,6-dioxopiperidin-3-yl)-1-hydroxyisoindol-5-yl]methyl]urea (PubChem CID 91391978) has the molecular formula C22H18ClF3N4O4 and a molecular weight of 494.86 g/mol. Its IUPAC name is 1-[3-chloro-4-(trifluoromethyl)phenyl]-3-[[2-(2,6-dioxopiperidin-3-yl)-1-hydroxyisoindol-5-yl]methyl]urea.
| Compound Name | 1-[3-chloro-4-(trifluoromethyl)phenyl]-3-[[2-(2,6-dioxopiperidin-3-yl)-1-hydroxyisoindol-5-yl]methyl]urea |
|---|---|
| PubChem CID | 91391978 |
| Molecular Formula | C22H18ClF3N4O4 |
| Molecular Weight | 494.86 g/mol |
| Exact Mass | 494.10 |
| IUPAC Name | 1-[3-chloro-4-(trifluoromethyl)phenyl]-3-[[2-(2,6-dioxopiperidin-3-yl)-1-hydroxyisoindol-5-yl]methyl]urea |
| SMILES | O=C1CCC(n2cc3cc(CNC(=O)Nc4ccc(C(F)(F)F)c(Cl)c4)ccc3c2O)C(=O)N1 |
| InChI | InChI=1S/C22H18ClF3N4O4/c23-16-8-13(2-4-15(16)22(24,25)26)28-21(34)27-9-11-1-3-14-12(7-11)10-30(20(14)33)17-5-6-18(31)29-19(17)32/h1-4,7-8,10,17,33H,5-6,9H2,(H2,27,28,34)(H,29,31,32) |
| InChIKey | BVNSVFZVNBZNEL-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 112.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.86 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|