C22H21BrN4O4 — CID 91280982
1-(4-bromo-3-methylphenyl)-3-[[2-(2,6-dioxopiperidin-3-yl)-1-hydroxyisoindol-5-yl]methyl]urea (PubChem CID 91280982) has the molecular formula C22H21BrN4O4 and a molecular weight of 485.34 g/mol. Its IUPAC name is 1-(4-bromo-3-methylphenyl)-3-[[2-(2,6-dioxopiperidin-3-yl)-1-hydroxyisoindol-5-yl]methyl]urea.
| Compound Name | 1-(4-bromo-3-methylphenyl)-3-[[2-(2,6-dioxopiperidin-3-yl)-1-hydroxyisoindol-5-yl]methyl]urea |
|---|---|
| PubChem CID | 91280982 |
| Molecular Formula | C22H21BrN4O4 |
| Molecular Weight | 485.34 g/mol |
| Exact Mass | 484.07 |
| IUPAC Name | 1-(4-bromo-3-methylphenyl)-3-[[2-(2,6-dioxopiperidin-3-yl)-1-hydroxyisoindol-5-yl]methyl]urea |
| SMILES | Cc1cc(NC(=O)NCc2ccc3c(O)n(C4CCC(=O)NC4=O)cc3c2)ccc1Br |
| InChI | InChI=1S/C22H21BrN4O4/c1-12-8-15(3-5-17(12)23)25-22(31)24-10-13-2-4-16-14(9-13)11-27(21(16)30)18-6-7-19(28)26-20(18)29/h2-5,8-9,11,18,30H,6-7,10H2,1H3,(H2,24,25,31)(H,26,28,29) |
| InChIKey | DJLYKPSKCYDGCB-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 112.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.34 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|