C24H19F2N5O4S — CID 90712002
1-[4-(2,4-difluorophenyl)-1,3-thiazol-2-yl]-3-[[2-(2,6-dioxopiperidin-3-yl)-1-hydroxyisoindol-5-yl]methyl]urea (PubChem CID 90712002) has the molecular formula C24H19F2N5O4S and a molecular weight of 511.51 g/mol. Its IUPAC name is 1-[4-(2,4-difluorophenyl)-1,3-thiazol-2-yl]-3-[[2-(2,6-dioxopiperidin-3-yl)-1-hydroxyisoindol-5-yl]methyl]urea.
| Compound Name | 1-[4-(2,4-difluorophenyl)-1,3-thiazol-2-yl]-3-[[2-(2,6-dioxopiperidin-3-yl)-1-hydroxyisoindol-5-yl]methyl]urea |
|---|---|
| PubChem CID | 90712002 |
| Molecular Formula | C24H19F2N5O4S |
| Molecular Weight | 511.51 g/mol |
| Exact Mass | 511.11 |
| IUPAC Name | 1-[4-(2,4-difluorophenyl)-1,3-thiazol-2-yl]-3-[[2-(2,6-dioxopiperidin-3-yl)-1-hydroxyisoindol-5-yl]methyl]urea |
| SMILES | O=C1CCC(n2cc3cc(CNC(=O)Nc4nc(-c5ccc(F)cc5F)cs4)ccc3c2O)C(=O)N1 |
| InChI | InChI=1S/C24H19F2N5O4S/c25-14-2-4-16(17(26)8-14)18-11-36-24(28-18)30-23(35)27-9-12-1-3-15-13(7-12)10-31(22(15)34)19-5-6-20(32)29-21(19)33/h1-4,7-8,10-11,19,34H,5-6,9H2,(H,29,32,33)(H2,27,28,30,35) |
| InChIKey | XVOPOVCQFPXUJJ-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 125.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.51 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|