C22H20ClN3O4 — CID 91539022
2-(3-chlorophenyl)-N-[[2-(2,6-dioxopiperidin-3-yl)-1-hydroxyisoindol-5-yl]methyl]acetamide (PubChem CID 91539022) has the molecular formula C22H20ClN3O4 and a molecular weight of 425.87 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-N-[[2-(2,6-dioxopiperidin-3-yl)-1-hydroxyisoindol-5-yl]methyl]acetamide.
| Compound Name | 2-(3-chlorophenyl)-N-[[2-(2,6-dioxopiperidin-3-yl)-1-hydroxyisoindol-5-yl]methyl]acetamide |
|---|---|
| PubChem CID | 91539022 |
| Molecular Formula | C22H20ClN3O4 |
| Molecular Weight | 425.87 g/mol |
| Exact Mass | 425.11 |
| IUPAC Name | 2-(3-chlorophenyl)-N-[[2-(2,6-dioxopiperidin-3-yl)-1-hydroxyisoindol-5-yl]methyl]acetamide |
| SMILES | O=C(Cc1cccc(Cl)c1)NCc1ccc2c(O)n(C3CCC(=O)NC3=O)cc2c1 |
| InChI | InChI=1S/C22H20ClN3O4/c23-16-3-1-2-13(9-16)10-20(28)24-11-14-4-5-17-15(8-14)12-26(22(17)30)18-6-7-19(27)25-21(18)29/h1-5,8-9,12,18,30H,6-7,10-11H2,(H,24,28)(H,25,27,29) |
| InChIKey | GFQJMSLKGHLERH-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 100.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.87 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|