C23H23N3O6S — CID 90871517
N-[[2-(2,6-dioxopiperidin-3-yl)-1-hydroxyisoindol-5-yl]methyl]-4-ethylsulfonylbenzamide (PubChem CID 90871517) has the molecular formula C23H23N3O6S and a molecular weight of 469.52 g/mol. Its IUPAC name is N-[[2-(2,6-dioxopiperidin-3-yl)-1-hydroxyisoindol-5-yl]methyl]-4-ethylsulfonylbenzamide.
| Compound Name | N-[[2-(2,6-dioxopiperidin-3-yl)-1-hydroxyisoindol-5-yl]methyl]-4-ethylsulfonylbenzamide |
|---|---|
| PubChem CID | 90871517 |
| Molecular Formula | C23H23N3O6S |
| Molecular Weight | 469.52 g/mol |
| Exact Mass | 469.13 |
| IUPAC Name | N-[[2-(2,6-dioxopiperidin-3-yl)-1-hydroxyisoindol-5-yl]methyl]-4-ethylsulfonylbenzamide |
| SMILES | CCS(=O)(=O)c1ccc(C(=O)NCc2ccc3c(O)n(C4CCC(=O)NC4=O)cc3c2)cc1 |
| InChI | InChI=1S/C23H23N3O6S/c1-2-33(31,32)17-6-4-15(5-7-17)21(28)24-12-14-3-8-18-16(11-14)13-26(23(18)30)19-9-10-20(27)25-22(19)29/h3-8,11,13,19,30H,2,9-10,12H2,1H3,(H,24,28)(H,25,27,29) |
| InChIKey | GWOKASNIFUECOQ-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 134.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.52 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|