C22H21N3O5 — CID 91476634
N-[[2-(2,6-dioxopiperidin-3-yl)-1-hydroxyisoindol-4-yl]methyl]-3-methoxybenzamide (PubChem CID 91476634) has the molecular formula C22H21N3O5 and a molecular weight of 407.43 g/mol. Its IUPAC name is N-[[2-(2,6-dioxopiperidin-3-yl)-1-hydroxyisoindol-4-yl]methyl]-3-methoxybenzamide.
| Compound Name | N-[[2-(2,6-dioxopiperidin-3-yl)-1-hydroxyisoindol-4-yl]methyl]-3-methoxybenzamide |
|---|---|
| PubChem CID | 91476634 |
| Molecular Formula | C22H21N3O5 |
| Molecular Weight | 407.43 g/mol |
| Exact Mass | 407.15 |
| IUPAC Name | N-[[2-(2,6-dioxopiperidin-3-yl)-1-hydroxyisoindol-4-yl]methyl]-3-methoxybenzamide |
| SMILES | COc1cccc(C(=O)NCc2cccc3c(O)n(C4CCC(=O)NC4=O)cc23)c1 |
| InChI | InChI=1S/C22H21N3O5/c1-30-15-6-2-4-13(10-15)20(27)23-11-14-5-3-7-16-17(14)12-25(22(16)29)18-8-9-19(26)24-21(18)28/h2-7,10,12,18,29H,8-9,11H2,1H3,(H,23,27)(H,24,26,28) |
| InChIKey | JQAFCJQGHPXLMQ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 109.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.43 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|