C23H21N5O4 — CID 123559413
1-[3-(cyanomethyl)phenyl]-3-[[2-(2,6-dioxopiperidin-3-yl)-1-hydroxyisoindol-4-yl]methyl]urea (PubChem CID 123559413) has the molecular formula C23H21N5O4 and a molecular weight of 431.45 g/mol. Its IUPAC name is 1-[3-(cyanomethyl)phenyl]-3-[[2-(2,6-dioxopiperidin-3-yl)-1-hydroxyisoindol-4-yl]methyl]urea.
| Compound Name | 1-[3-(cyanomethyl)phenyl]-3-[[2-(2,6-dioxopiperidin-3-yl)-1-hydroxyisoindol-4-yl]methyl]urea |
|---|---|
| PubChem CID | 123559413 |
| Molecular Formula | C23H21N5O4 |
| Molecular Weight | 431.45 g/mol |
| Exact Mass | 431.16 |
| IUPAC Name | 1-[3-(cyanomethyl)phenyl]-3-[[2-(2,6-dioxopiperidin-3-yl)-1-hydroxyisoindol-4-yl]methyl]urea |
| SMILES | N#CCc1cccc(NC(=O)NCc2cccc3c(O)n(C4CCC(=O)NC4=O)cc23)c1 |
| InChI | InChI=1S/C23H21N5O4/c24-10-9-14-3-1-5-16(11-14)26-23(32)25-12-15-4-2-6-17-18(15)13-28(22(17)31)19-7-8-20(29)27-21(19)30/h1-6,11,13,19,31H,7-9,12H2,(H2,25,26,32)(H,27,29,30) |
| InChIKey | HLZAAVLWOLYEJP-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 136.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.45 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|