C14H11N3O3 — CID 91259268
2-(2,6-dioxopiperidin-3-yl)-1-hydroxyisoindole-4-carbonitrile (PubChem CID 91259268) has the molecular formula C14H11N3O3 and a molecular weight of 269.26 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-1-hydroxyisoindole-4-carbonitrile.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-1-hydroxyisoindole-4-carbonitrile |
|---|---|
| PubChem CID | 91259268 |
| Molecular Formula | C14H11N3O3 |
| Molecular Weight | 269.26 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-1-hydroxyisoindole-4-carbonitrile |
| SMILES | N#Cc1cccc2c(O)n(C3CCC(=O)NC3=O)cc12 |
| InChI | InChI=1S/C14H11N3O3/c15-6-8-2-1-3-9-10(8)7-17(14(9)20)11-4-5-12(18)16-13(11)19/h1-3,7,11,20H,4-5H2,(H,16,18,19) |
| InChIKey | RQMMYWMJCCAFHA-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.26 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|