C23H20ClF3N4O4 — CID 135326129
1-[3-chloro-4-(trifluoromethyl)phenyl]-3-[[2-(2,7-dioxoazepan-3-yl)-1-oxo-3H-isoindol-5-yl]methyl]urea (PubChem CID 135326129) has the molecular formula C23H20ClF3N4O4 and a molecular weight of 508.88 g/mol. Its IUPAC name is 1-[3-chloro-4-(trifluoromethyl)phenyl]-3-[[2-(2,7-dioxoazepan-3-yl)-1-oxo-3H-isoindol-5-yl]methyl]urea.
| Compound Name | 1-[3-chloro-4-(trifluoromethyl)phenyl]-3-[[2-(2,7-dioxoazepan-3-yl)-1-oxo-3H-isoindol-5-yl]methyl]urea |
|---|---|
| PubChem CID | 135326129 |
| Molecular Formula | C23H20ClF3N4O4 |
| Molecular Weight | 508.88 g/mol |
| Exact Mass | 508.11 |
| IUPAC Name | 1-[3-chloro-4-(trifluoromethyl)phenyl]-3-[[2-(2,7-dioxoazepan-3-yl)-1-oxo-3H-isoindol-5-yl]methyl]urea |
| SMILES | O=C1CCCC(N2Cc3cc(CNC(=O)Nc4ccc(C(F)(F)F)c(Cl)c4)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C23H20ClF3N4O4/c24-17-9-14(5-7-16(17)23(25,26)27)29-22(35)28-10-12-4-6-15-13(8-12)11-31(21(15)34)18-2-1-3-19(32)30-20(18)33/h4-9,18H,1-3,10-11H2,(H2,28,29,35)(H,30,32,33) |
| InChIKey | CEVTWLGQBYVOGU-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.88 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|