C23H23ClN4O5 — CID 135326053
1-(3-chloro-4-methoxyphenyl)-3-[[2-(2,7-dioxoazepan-3-yl)-1-oxo-3H-isoindol-5-yl]methyl]urea (PubChem CID 135326053) has the molecular formula C23H23ClN4O5 and a molecular weight of 470.91 g/mol. Its IUPAC name is 1-(3-chloro-4-methoxyphenyl)-3-[[2-(2,7-dioxoazepan-3-yl)-1-oxo-3H-isoindol-5-yl]methyl]urea.
| Compound Name | 1-(3-chloro-4-methoxyphenyl)-3-[[2-(2,7-dioxoazepan-3-yl)-1-oxo-3H-isoindol-5-yl]methyl]urea |
|---|---|
| PubChem CID | 135326053 |
| Molecular Formula | C23H23ClN4O5 |
| Molecular Weight | 470.91 g/mol |
| Exact Mass | 470.14 |
| IUPAC Name | 1-(3-chloro-4-methoxyphenyl)-3-[[2-(2,7-dioxoazepan-3-yl)-1-oxo-3H-isoindol-5-yl]methyl]urea |
| SMILES | COc1ccc(NC(=O)NCc2ccc3c(c2)CN(C2CCCC(=O)NC2=O)C3=O)cc1Cl |
| InChI | InChI=1S/C23H23ClN4O5/c1-33-19-8-6-15(10-17(19)24)26-23(32)25-11-13-5-7-16-14(9-13)12-28(22(16)31)18-3-2-4-20(29)27-21(18)30/h5-10,18H,2-4,11-12H2,1H3,(H2,25,26,32)(H,27,29,30) |
| InChIKey | CFLPWAKHBCPZTP-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.91 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|