C25H28N4O5 — CID 172547328
1-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methyl]-3-(3-methoxy-5-propan-2-ylphenyl)urea (PubChem CID 172547328) has the molecular formula C25H28N4O5 and a molecular weight of 464.52 g/mol. Its IUPAC name is 1-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methyl]-3-(3-methoxy-5-propan-2-ylphenyl)urea.
| Compound Name | 1-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methyl]-3-(3-methoxy-5-propan-2-ylphenyl)urea |
|---|---|
| PubChem CID | 172547328 |
| Molecular Formula | C25H28N4O5 |
| Molecular Weight | 464.52 g/mol |
| Exact Mass | 464.21 |
| IUPAC Name | 1-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methyl]-3-(3-methoxy-5-propan-2-ylphenyl)urea |
| SMILES | COc1cc(NC(=O)NCc2ccc3c(c2)CN(C2CCC(=O)NC2=O)C3=O)cc(C(C)C)c1 |
| InChI | InChI=1S/C25H28N4O5/c1-14(2)16-9-18(11-19(10-16)34-3)27-25(33)26-12-15-4-5-20-17(8-15)13-29(24(20)32)21-6-7-22(30)28-23(21)31/h4-5,8-11,14,21H,6-7,12-13H2,1-3H3,(H2,26,27,33)(H,28,30,31) |
| InChIKey | CYEVJLBMBBFGJP-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.52 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|