C30H33N5O5 — CID 176989736
1-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methyl]-3-[4-[(4-methylphenyl)methoxy]phenyl]urea;methanamine (PubChem CID 176989736) has the molecular formula C30H33N5O5 and a molecular weight of 543.62 g/mol. Its IUPAC name is 1-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methyl]-3-[4-[(4-methylphenyl)methoxy]phenyl]urea;methanamine.
| Compound Name | 1-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methyl]-3-[4-[(4-methylphenyl)methoxy]phenyl]urea;methanamine |
|---|---|
| PubChem CID | 176989736 |
| Molecular Formula | C30H33N5O5 |
| Molecular Weight | 543.62 g/mol |
| Exact Mass | 543.25 |
| IUPAC Name | 1-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methyl]-3-[4-[(4-methylphenyl)methoxy]phenyl]urea;methanamine |
| SMILES | CN.Cc1ccc(COc2ccc(NC(=O)NCc3ccc4c(c3)CN(C3CCC(=O)NC3=O)C4=O)cc2)cc1 |
| InChI | InChI=1S/C29H28N4O5.CH5N/c1-18-2-4-19(5-3-18)17-38-23-9-7-22(8-10-23)31-29(37)30-15-20-6-11-24-21(14-20)16-33(28(24)36)25-12-13-26(34)32-27(25)35;1-2/h2-11,14,25H,12-13,15-17H2,1H3,(H2,30,31,37)(H,32,34,35);2H2,1H3 |
| InChIKey | PKPAQWWZZXCBRB-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 142.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.62 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|