C24H25N5O6 — CID 46198553
[5-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methylcarbamoylamino]-2-methylphenyl] 2-aminoacetate (PubChem CID 46198553) has the molecular formula C24H25N5O6 and a molecular weight of 479.49 g/mol. Its IUPAC name is [5-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methylcarbamoylamino]-2-methylphenyl] 2-aminoacetate.
| Compound Name | [5-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methylcarbamoylamino]-2-methylphenyl] 2-aminoacetate |
|---|---|
| PubChem CID | 46198553 |
| Molecular Formula | C24H25N5O6 |
| Molecular Weight | 479.49 g/mol |
| Exact Mass | 479.18 |
| IUPAC Name | [5-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methylcarbamoylamino]-2-methylphenyl] 2-aminoacetate |
| SMILES | Cc1ccc(NC(=O)NCc2ccc3c(c2)CN(C2CCC(=O)NC2=O)C3=O)cc1OC(=O)CN |
| InChI | InChI=1S/C24H25N5O6/c1-13-2-4-16(9-19(13)35-21(31)10-25)27-24(34)26-11-14-3-5-17-15(8-14)12-29(23(17)33)18-6-7-20(30)28-22(18)32/h2-5,8-9,18H,6-7,10-12,25H2,1H3,(H2,26,27,34)(H,28,30,32) |
| InChIKey | INGRYZNPPCJESC-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 159.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.49 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|