C26H29ClN6O6 — CID 166154435
2-amino-N-[2-[2-chloro-4-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methylcarbamoylamino]phenyl]ethoxymethyl]acetamide (PubChem CID 166154435) has the molecular formula C26H29ClN6O6 and a molecular weight of 557.01 g/mol. Its IUPAC name is 2-amino-N-[2-[2-chloro-4-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methylcarbamoylamino]phenyl]ethoxymethyl]acetamide.
| Compound Name | 2-amino-N-[2-[2-chloro-4-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methylcarbamoylamino]phenyl]ethoxymethyl]acetamide |
|---|---|
| PubChem CID | 166154435 |
| Molecular Formula | C26H29ClN6O6 |
| Molecular Weight | 557.01 g/mol |
| Exact Mass | 556.18 |
| IUPAC Name | 2-amino-N-[2-[2-chloro-4-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methylcarbamoylamino]phenyl]ethoxymethyl]acetamide |
| SMILES | NCC(=O)NCOCCc1ccc(NC(=O)NCc2ccc3c(c2)CN(C2CCC(=O)NC2=O)C3=O)cc1Cl |
| InChI | InChI=1S/C26H29ClN6O6/c27-20-10-18(3-2-16(20)7-8-39-14-30-23(35)11-28)31-26(38)29-12-15-1-4-19-17(9-15)13-33(25(19)37)21-5-6-22(34)32-24(21)36/h1-4,9-10,21H,5-8,11-14,28H2,(H,30,35)(H2,29,31,38)(H,32,34,36) |
| InChIKey | IQQAVGZZXQHFQN-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 171.96 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.01 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|