C24H26ClN5O4 — CID 163235302
1-[4-chloro-3-(propan-2-ylamino)phenyl]-3-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methyl]urea (PubChem CID 163235302) has the molecular formula C24H26ClN5O4 and a molecular weight of 483.96 g/mol. Its IUPAC name is 1-[4-chloro-3-(propan-2-ylamino)phenyl]-3-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methyl]urea.
| Compound Name | 1-[4-chloro-3-(propan-2-ylamino)phenyl]-3-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methyl]urea |
|---|---|
| PubChem CID | 163235302 |
| Molecular Formula | C24H26ClN5O4 |
| Molecular Weight | 483.96 g/mol |
| Exact Mass | 483.17 |
| IUPAC Name | 1-[4-chloro-3-(propan-2-ylamino)phenyl]-3-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methyl]urea |
| SMILES | CC(C)Nc1cc(NC(=O)NCc2ccc3c(c2)CN(C2CCC(=O)NC2=O)C3=O)ccc1Cl |
| InChI | InChI=1S/C24H26ClN5O4/c1-13(2)27-19-10-16(4-6-18(19)25)28-24(34)26-11-14-3-5-17-15(9-14)12-30(23(17)33)20-7-8-21(31)29-22(20)32/h3-6,9-10,13,20,27H,7-8,11-12H2,1-2H3,(H2,26,28,34)(H,29,31,32) |
| InChIKey | ZJTVBFHKIPDZGG-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 119.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.96 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|