C23H23ClN4O4 — CID 135326115
1-(3-chloro-2-methylphenyl)-3-[[2-(2,7-dioxoazepan-3-yl)-1-oxo-3H-isoindol-5-yl]methyl]urea (PubChem CID 135326115) has the molecular formula C23H23ClN4O4 and a molecular weight of 454.91 g/mol. Its IUPAC name is 1-(3-chloro-2-methylphenyl)-3-[[2-(2,7-dioxoazepan-3-yl)-1-oxo-3H-isoindol-5-yl]methyl]urea.
| Compound Name | 1-(3-chloro-2-methylphenyl)-3-[[2-(2,7-dioxoazepan-3-yl)-1-oxo-3H-isoindol-5-yl]methyl]urea |
|---|---|
| PubChem CID | 135326115 |
| Molecular Formula | C23H23ClN4O4 |
| Molecular Weight | 454.91 g/mol |
| Exact Mass | 454.14 |
| IUPAC Name | 1-(3-chloro-2-methylphenyl)-3-[[2-(2,7-dioxoazepan-3-yl)-1-oxo-3H-isoindol-5-yl]methyl]urea |
| SMILES | Cc1c(Cl)cccc1NC(=O)NCc1ccc2c(c1)CN(C1CCCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C23H23ClN4O4/c1-13-17(24)4-2-5-18(13)26-23(32)25-11-14-8-9-16-15(10-14)12-28(22(16)31)19-6-3-7-20(29)27-21(19)30/h2,4-5,8-10,19H,3,6-7,11-12H2,1H3,(H2,25,26,32)(H,27,29,30) |
| InChIKey | IVCPMMIJPAPYSD-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.91 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|