C24H25ClN4O4 — CID 135326104
1-(3-chloro-4-methylphenyl)-3-[2-[2-(2,7-dioxoazepan-3-yl)-1-oxo-3H-isoindol-5-yl]ethyl]urea (PubChem CID 135326104) has the molecular formula C24H25ClN4O4 and a molecular weight of 468.94 g/mol. Its IUPAC name is 1-(3-chloro-4-methylphenyl)-3-[2-[2-(2,7-dioxoazepan-3-yl)-1-oxo-3H-isoindol-5-yl]ethyl]urea.
| Compound Name | 1-(3-chloro-4-methylphenyl)-3-[2-[2-(2,7-dioxoazepan-3-yl)-1-oxo-3H-isoindol-5-yl]ethyl]urea |
|---|---|
| PubChem CID | 135326104 |
| Molecular Formula | C24H25ClN4O4 |
| Molecular Weight | 468.94 g/mol |
| Exact Mass | 468.16 |
| IUPAC Name | 1-(3-chloro-4-methylphenyl)-3-[2-[2-(2,7-dioxoazepan-3-yl)-1-oxo-3H-isoindol-5-yl]ethyl]urea |
| SMILES | Cc1ccc(NC(=O)NCCc2ccc3c(c2)CN(C2CCCC(=O)NC2=O)C3=O)cc1Cl |
| InChI | InChI=1S/C24H25ClN4O4/c1-14-5-7-17(12-19(14)25)27-24(33)26-10-9-15-6-8-18-16(11-15)13-29(23(18)32)20-3-2-4-21(30)28-22(20)31/h5-8,11-12,20H,2-4,9-10,13H2,1H3,(H2,26,27,33)(H,28,30,31) |
| InChIKey | OYTKLSFPTQWXBY-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.94 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|