C25H24N6O4 — CID 46200746
1-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methyl]-3-[3-(2-methylimidazol-1-yl)phenyl]urea (PubChem CID 46200746) has the molecular formula C25H24N6O4 and a molecular weight of 472.51 g/mol. Its IUPAC name is 1-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methyl]-3-[3-(2-methylimidazol-1-yl)phenyl]urea.
| Compound Name | 1-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methyl]-3-[3-(2-methylimidazol-1-yl)phenyl]urea |
|---|---|
| PubChem CID | 46200746 |
| Molecular Formula | C25H24N6O4 |
| Molecular Weight | 472.51 g/mol |
| Exact Mass | 472.19 |
| IUPAC Name | 1-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methyl]-3-[3-(2-methylimidazol-1-yl)phenyl]urea |
| SMILES | Cc1nccn1-c1cccc(NC(=O)NCc2ccc3c(c2)CN(C2CCC(=O)NC2=O)C3=O)c1 |
| InChI | InChI=1S/C25H24N6O4/c1-15-26-9-10-30(15)19-4-2-3-18(12-19)28-25(35)27-13-16-5-6-20-17(11-16)14-31(24(20)34)21-7-8-22(32)29-23(21)33/h2-6,9-12,21H,7-8,13-14H2,1H3,(H2,27,28,35)(H,29,32,33) |
| InChIKey | IFPYUZWCTVIKCF-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 125.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.51 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|