C13H12BN4O3 — CID 174168195
CID 174168195 (PubChem CID 174168195) has the molecular formula C13H12BN4O3 and a molecular weight of 283.08 g/mol.
| Compound Name | CID 174168195 |
|---|---|
| PubChem CID | 174168195 |
| Molecular Formula | C13H12BN4O3 |
| Molecular Weight | 283.08 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | — |
| SMILES | C[B]c1ccc2c(=O)n(C3CCC(=O)NC3=O)nnc2c1 |
| InChI | InChI=1S/C13H12BN4O3/c1-14-7-2-3-8-9(6-7)16-17-18(13(8)21)10-4-5-11(19)15-12(10)20/h2-3,6,10H,4-5H2,1H3,(H,15,19,20) |
| InChIKey | DVONYIWBXYIANI-UHFFFAOYSA-N |
| XLogP | -0.85 |
| TPSA | 93.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.08 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|