C25H26N6O4 — CID 151519054
1-[1-[3-(2,6-dioxopiperidin-3-yl)-4-oxo-1,2,3-benzotriazin-6-yl]ethyl]-3-(5,6,7,8-tetrahydronaphthalen-2-yl)urea (PubChem CID 151519054) has the molecular formula C25H26N6O4 and a molecular weight of 474.52 g/mol. Its IUPAC name is 1-[1-[3-(2,6-dioxopiperidin-3-yl)-4-oxo-1,2,3-benzotriazin-6-yl]ethyl]-3-(5,6,7,8-tetrahydronaphthalen-2-yl)urea.
| Compound Name | 1-[1-[3-(2,6-dioxopiperidin-3-yl)-4-oxo-1,2,3-benzotriazin-6-yl]ethyl]-3-(5,6,7,8-tetrahydronaphthalen-2-yl)urea |
|---|---|
| PubChem CID | 151519054 |
| Molecular Formula | C25H26N6O4 |
| Molecular Weight | 474.52 g/mol |
| Exact Mass | 474.20 |
| IUPAC Name | 1-[1-[3-(2,6-dioxopiperidin-3-yl)-4-oxo-1,2,3-benzotriazin-6-yl]ethyl]-3-(5,6,7,8-tetrahydronaphthalen-2-yl)urea |
| SMILES | CC(NC(=O)Nc1ccc2c(c1)CCCC2)c1ccc2nnn(C3CCC(=O)NC3=O)c(=O)c2c1 |
| InChI | InChI=1S/C25H26N6O4/c1-14(26-25(35)27-18-8-6-15-4-2-3-5-17(15)12-18)16-7-9-20-19(13-16)24(34)31(30-29-20)21-10-11-22(32)28-23(21)33/h6-9,12-14,21H,2-5,10-11H2,1H3,(H2,26,27,35)(H,28,32,33) |
| InChIKey | PUBXEQUSBOMAPR-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 135.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.52 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|