C16H19N5O3 — CID 162504232
3-[6-(tert-butylamino)-4-oxo-1,2,3-benzotriazin-3-yl]piperidine-2,6-dione (PubChem CID 162504232) has the molecular formula C16H19N5O3 and a molecular weight of 329.36 g/mol. Its IUPAC name is 3-[6-(tert-butylamino)-4-oxo-1,2,3-benzotriazin-3-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-(tert-butylamino)-4-oxo-1,2,3-benzotriazin-3-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 162504232 |
| Molecular Formula | C16H19N5O3 |
| Molecular Weight | 329.36 g/mol |
| Exact Mass | 329.15 |
| IUPAC Name | 3-[6-(tert-butylamino)-4-oxo-1,2,3-benzotriazin-3-yl]piperidine-2,6-dione |
| SMILES | CC(C)(C)Nc1ccc2nnn(C3CCC(=O)NC3=O)c(=O)c2c1 |
| InChI | InChI=1S/C16H19N5O3/c1-16(2,3)18-9-4-5-11-10(8-9)15(24)21(20-19-11)12-6-7-13(22)17-14(12)23/h4-5,8,12,18H,6-7H2,1-3H3,(H,17,22,23) |
| InChIKey | LDPHDPBNDIMLET-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 105.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.36 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|