C16H18N4O3 — CID 162504276
3-(6-tert-butyl-4-oxo-1,2,3-benzotriazin-3-yl)piperidine-2,6-dione (PubChem CID 162504276) has the molecular formula C16H18N4O3 and a molecular weight of 314.35 g/mol. Its IUPAC name is 3-(6-tert-butyl-4-oxo-1,2,3-benzotriazin-3-yl)piperidine-2,6-dione.
| Compound Name | 3-(6-tert-butyl-4-oxo-1,2,3-benzotriazin-3-yl)piperidine-2,6-dione |
|---|---|
| PubChem CID | 162504276 |
| Molecular Formula | C16H18N4O3 |
| Molecular Weight | 314.35 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | 3-(6-tert-butyl-4-oxo-1,2,3-benzotriazin-3-yl)piperidine-2,6-dione |
| SMILES | CC(C)(C)c1ccc2nnn(C3CCC(=O)NC3=O)c(=O)c2c1 |
| InChI | InChI=1S/C16H18N4O3/c1-16(2,3)9-4-5-11-10(8-9)15(23)20(19-18-11)12-6-7-13(21)17-14(12)22/h4-5,8,12H,6-7H2,1-3H3,(H,17,21,22) |
| InChIKey | DOWFOMPXBDIRLB-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 93.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.35 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|