C16H21N3O3 — CID 171626775
ethane;3-(6-methyl-4-oxoquinazolin-3-yl)piperidine-2,6-dione;molecular hydrogen (PubChem CID 171626775) has the molecular formula C16H21N3O3 and a molecular weight of 303.36 g/mol. Its IUPAC name is ethane;3-(6-methyl-4-oxoquinazolin-3-yl)piperidine-2,6-dione;molecular hydrogen.
| Compound Name | ethane;3-(6-methyl-4-oxoquinazolin-3-yl)piperidine-2,6-dione;molecular hydrogen |
|---|---|
| PubChem CID | 171626775 |
| Molecular Formula | C16H21N3O3 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | ethane;3-(6-methyl-4-oxoquinazolin-3-yl)piperidine-2,6-dione;molecular hydrogen |
| SMILES | CC.Cc1ccc2ncn(C3CCC(=O)NC3=O)c(=O)c2c1.[H][H] |
| InChI | InChI=1S/C14H13N3O3.C2H6.H2/c1-8-2-3-10-9(6-8)14(20)17(7-15-10)11-4-5-12(18)16-13(11)19;1-2;/h2-3,6-7,11H,4-5H2,1H3,(H,16,18,19);1-2H3;1H |
| InChIKey | WVRYNYKGVYSNOY-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|