C25H31N5O5 — CID 155212116
tert-butyl 2-[3-(2,6-dioxopiperidin-3-yl)-4-oxoquinazolin-7-yl]-2,7-diazaspiro[3.5]nonane-7-carboxylate (PubChem CID 155212116) has the molecular formula C25H31N5O5 and a molecular weight of 481.55 g/mol. Its IUPAC name is tert-butyl 2-[3-(2,6-dioxopiperidin-3-yl)-4-oxoquinazolin-7-yl]-2,7-diazaspiro[3.5]nonane-7-carboxylate.
| Compound Name | tert-butyl 2-[3-(2,6-dioxopiperidin-3-yl)-4-oxoquinazolin-7-yl]-2,7-diazaspiro[3.5]nonane-7-carboxylate |
|---|---|
| PubChem CID | 155212116 |
| Molecular Formula | C25H31N5O5 |
| Molecular Weight | 481.55 g/mol |
| Exact Mass | 481.23 |
| IUPAC Name | tert-butyl 2-[3-(2,6-dioxopiperidin-3-yl)-4-oxoquinazolin-7-yl]-2,7-diazaspiro[3.5]nonane-7-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CC1)CN(c1ccc3c(=O)n(C4CCC(=O)NC4=O)cnc3c1)C2 |
| InChI | InChI=1S/C25H31N5O5/c1-24(2,3)35-23(34)28-10-8-25(9-11-28)13-29(14-25)16-4-5-17-18(12-16)26-15-30(22(17)33)19-6-7-20(31)27-21(19)32/h4-5,12,15,19H,6-11,13-14H2,1-3H3,(H,27,31,32) |
| InChIKey | MDKVXIRMYFSRBY-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 113.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.55 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|