C23H33N3O4 — CID 170979336
tert-butyl 6-[3-(2,6-dioxopiperidin-3-yl)phenyl]-2,6-diazaspiro[3.3]heptane-2-carboxylate;ethane (PubChem CID 170979336) has the molecular formula C23H33N3O4 and a molecular weight of 415.53 g/mol. Its IUPAC name is tert-butyl 6-[3-(2,6-dioxopiperidin-3-yl)phenyl]-2,6-diazaspiro[3.3]heptane-2-carboxylate;ethane.
| Compound Name | tert-butyl 6-[3-(2,6-dioxopiperidin-3-yl)phenyl]-2,6-diazaspiro[3.3]heptane-2-carboxylate;ethane |
|---|---|
| PubChem CID | 170979336 |
| Molecular Formula | C23H33N3O4 |
| Molecular Weight | 415.53 g/mol |
| Exact Mass | 415.25 |
| IUPAC Name | tert-butyl 6-[3-(2,6-dioxopiperidin-3-yl)phenyl]-2,6-diazaspiro[3.3]heptane-2-carboxylate;ethane |
| SMILES | CC.CC(C)(C)OC(=O)N1CC2(C1)CN(c1cccc(C3CCC(=O)NC3=O)c1)C2 |
| InChI | InChI=1S/C21H27N3O4.C2H6/c1-20(2,3)28-19(27)24-12-21(13-24)10-23(11-21)15-6-4-5-14(9-15)16-7-8-17(25)22-18(16)26;1-2/h4-6,9,16H,7-8,10-13H2,1-3H3,(H,22,25,26);1-2H3 |
| InChIKey | ZBOKBFDTUWJVLD-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.53 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|