C18H23N3O2 — CID 170979872
3-[3-(2,7-diazaspiro[3.5]nonan-2-yl)phenyl]piperidine-2,6-dione (PubChem CID 170979872) has the molecular formula C18H23N3O2 and a molecular weight of 313.40 g/mol. Its IUPAC name is 3-[3-(2,7-diazaspiro[3.5]nonan-2-yl)phenyl]piperidine-2,6-dione.
| Compound Name | 3-[3-(2,7-diazaspiro[3.5]nonan-2-yl)phenyl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 170979872 |
| Molecular Formula | C18H23N3O2 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.18 |
| IUPAC Name | 3-[3-(2,7-diazaspiro[3.5]nonan-2-yl)phenyl]piperidine-2,6-dione |
| SMILES | O=C1CCC(c2cccc(N3CC4(CCNCC4)C3)c2)C(=O)N1 |
| InChI | InChI=1S/C18H23N3O2/c22-16-5-4-15(17(23)20-16)13-2-1-3-14(10-13)21-11-18(12-21)6-8-19-9-7-18/h1-3,10,15,19H,4-9,11-12H2,(H,20,22,23) |
| InChIKey | SUGGCNWOKYEQND-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|