C11H10BNO2 — CID 177052361
CID 177052361 (PubChem CID 177052361) has the molecular formula C11H10BNO2 and a molecular weight of 199.02 g/mol.
| Compound Name | CID 177052361 |
|---|---|
| PubChem CID | 177052361 |
| Molecular Formula | C11H10BNO2 |
| Molecular Weight | 199.02 g/mol |
| Exact Mass | 199.08 |
| IUPAC Name | — |
| SMILES | [B]c1cccc(C2CCC(=O)NC2=O)c1 |
| InChI | InChI=1S/C11H10BNO2/c12-8-3-1-2-7(6-8)9-4-5-10(14)13-11(9)15/h1-3,6,9H,4-5H2,(H,13,14,15) |
| InChIKey | VWUBVIMZZNRJJX-UHFFFAOYSA-N |
| XLogP | 0.00 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.02 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|