C14H24N2O2 — CID 177198142
ethane;molecular hydrogen;3-pyridin-3-ylpiperidine-2,6-dione (PubChem CID 177198142) has the molecular formula C14H24N2O2 and a molecular weight of 252.36 g/mol. Its IUPAC name is ethane;molecular hydrogen;3-pyridin-3-ylpiperidine-2,6-dione.
| Compound Name | ethane;molecular hydrogen;3-pyridin-3-ylpiperidine-2,6-dione |
|---|---|
| PubChem CID | 177198142 |
| Molecular Formula | C14H24N2O2 |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.18 |
| IUPAC Name | ethane;molecular hydrogen;3-pyridin-3-ylpiperidine-2,6-dione |
| SMILES | CC.CC.O=C1CCC(c2cccnc2)C(=O)N1.[H][H] |
| InChI | InChI=1S/C10H10N2O2.2C2H6.H2/c13-9-4-3-8(10(14)12-9)7-2-1-5-11-6-7;2*1-2;/h1-2,5-6,8H,3-4H2,(H,12,13,14);2*1-2H3;1H |
| InChIKey | BKPZKSHAUIQTHJ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|