C10H12ClN3O2 — CID 166552755
3-(6-amino-3-pyridinyl)piperidine-2,6-dione;hydrochloride (PubChem CID 166552755) has the molecular formula C10H12ClN3O2 and a molecular weight of 241.68 g/mol. Its IUPAC name is 3-(6-amino-3-pyridinyl)piperidine-2,6-dione;hydrochloride.
| Compound Name | 3-(6-amino-3-pyridinyl)piperidine-2,6-dione;hydrochloride |
|---|---|
| PubChem CID | 166552755 |
| Molecular Formula | C10H12ClN3O2 |
| Molecular Weight | 241.68 g/mol |
| Exact Mass | 241.06 |
| IUPAC Name | 3-(6-amino-3-pyridinyl)piperidine-2,6-dione;hydrochloride |
| SMILES | Cl.Nc1ccc(C2CCC(=O)NC2=O)cn1 |
| InChI | InChI=1S/C10H11N3O2.ClH/c11-8-3-1-6(5-12-8)7-2-4-9(14)13-10(7)15;/h1,3,5,7H,2,4H2,(H2,11,12)(H,13,14,15);1H |
| InChIKey | ZOYHNPJOMYGKHO-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.68 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|