C9H10N4O2 — CID 177240318
3-(5-aminopyrimidin-2-yl)piperidine-2,6-dione (PubChem CID 177240318) has the molecular formula C9H10N4O2 and a molecular weight of 206.20 g/mol. Its IUPAC name is 3-(5-aminopyrimidin-2-yl)piperidine-2,6-dione.
| Compound Name | 3-(5-aminopyrimidin-2-yl)piperidine-2,6-dione |
|---|---|
| PubChem CID | 177240318 |
| Molecular Formula | C9H10N4O2 |
| Molecular Weight | 206.20 g/mol |
| Exact Mass | 206.08 |
| IUPAC Name | 3-(5-aminopyrimidin-2-yl)piperidine-2,6-dione |
| SMILES | Nc1cnc(C2CCC(=O)NC2=O)nc1 |
| InChI | InChI=1S/C9H10N4O2/c10-5-3-11-8(12-4-5)6-1-2-7(14)13-9(6)15/h3-4,6H,1-2,10H2,(H,13,14,15) |
| InChIKey | OQFCCZMUVZQWHP-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.20 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|