C13H17N3O2 — CID 168842408
3-(4-tert-butylpyrimidin-2-yl)piperidine-2,6-dione (PubChem CID 168842408) has the molecular formula C13H17N3O2 and a molecular weight of 247.30 g/mol. Its IUPAC name is 3-(4-tert-butylpyrimidin-2-yl)piperidine-2,6-dione.
| Compound Name | 3-(4-tert-butylpyrimidin-2-yl)piperidine-2,6-dione |
|---|---|
| PubChem CID | 168842408 |
| Molecular Formula | C13H17N3O2 |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.13 |
| IUPAC Name | 3-(4-tert-butylpyrimidin-2-yl)piperidine-2,6-dione |
| SMILES | CC(C)(C)c1ccnc(C2CCC(=O)NC2=O)n1 |
| InChI | InChI=1S/C13H17N3O2/c1-13(2,3)9-6-7-14-11(15-9)8-4-5-10(17)16-12(8)18/h6-8H,4-5H2,1-3H3,(H,16,17,18) |
| InChIKey | XABGPAHQHNKFFG-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|