About 3-(4-aminophenyl)piperidine-2,6-dione;ethane
3-(4-aminophenyl)piperidine-2,6-dione;ethane (PubChem CID 177052461) has the molecular formula C15H24N2O2
and a molecular weight of 264.37 g/mol. Its IUPAC name is 3-(4-aminophenyl)piperidine-2,6-dione;ethane.
Molecular Properties
| Compound Name | 3-(4-aminophenyl)piperidine-2,6-dione;ethane |
| PubChem CID | 177052461 |
| Molecular Formula | C15H24N2O2 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.18 |
| IUPAC Name | 3-(4-aminophenyl)piperidine-2,6-dione;ethane |
| SMILES | CC.CC.Nc1ccc(C2CCC(=O)NC2=O)cc1 |
| InChI | InChI=1S/C11H12N2O2.2C2H6/c12-8-3-1-7(2-4-8)9-5-6-10(14)13-11(9)15;2*1-2/h1-4,9H,5-6,12H2,(H,13,14,15);2*1-2H3 |
| InChIKey | ZTUXCMSLGHBRDV-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 3-(4-aminophenyl)piperidine-2,6-dione;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-aminophenyl)piperidine-2,6-dione;ethane?
The IUPAC name of 3-(4-aminophenyl)piperidine-2,6-dione;ethane (CID 177052461) is 3-(4-aminophenyl)piperidine-2,6-dione;ethane.
What is the SMILES notation for 3-(4-aminophenyl)piperidine-2,6-dione;ethane?
The canonical SMILES for 3-(4-aminophenyl)piperidine-2,6-dione;ethane is CC.CC.Nc1ccc(C2CCC(=O)NC2=O)cc1.
What is the InChIKey of 3-(4-aminophenyl)piperidine-2,6-dione;ethane?
The InChIKey is ZTUXCMSLGHBRDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N2O2.2C2H6/c12-8-3-1-7(2-4-8)9-5-6-10(14)13-11(9)15;2*1-2/h1-4,9H,5-6,12H2,(H,13,14,15);2*1-2H3.
What are the key properties of 3-(4-aminophenyl)piperidine-2,6-dione;ethane?
3-(4-aminophenyl)piperidine-2,6-dione;ethane has a molecular weight of 264.37 g/mol, XLogP of 2.84, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-aminophenyl)piperidine-2,6-dione;ethane is sourced from PubChem (CID 177052461), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).