C16H17NO3 — CID 166947876
3-[4-(3-oxocyclopentyl)phenyl]piperidine-2,6-dione (PubChem CID 166947876) has the molecular formula C16H17NO3 and a molecular weight of 271.32 g/mol. Its IUPAC name is 3-[4-(3-oxocyclopentyl)phenyl]piperidine-2,6-dione.
| Compound Name | 3-[4-(3-oxocyclopentyl)phenyl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 166947876 |
| Molecular Formula | C16H17NO3 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | 3-[4-(3-oxocyclopentyl)phenyl]piperidine-2,6-dione |
| SMILES | O=C1CCC(c2ccc(C3CCC(=O)NC3=O)cc2)C1 |
| InChI | InChI=1S/C16H17NO3/c18-13-6-5-12(9-13)10-1-3-11(4-2-10)14-7-8-15(19)17-16(14)20/h1-4,12,14H,5-9H2,(H,17,19,20) |
| InChIKey | ANXGNEVEGCKTDZ-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|