C16H19NO2 — CID 82120778
3-(4-cyclohexylphenyl)pyrrolidine-2,5-dione (PubChem CID 82120778) has the molecular formula C16H19NO2 and a molecular weight of 257.33 g/mol. Its IUPAC name is 3-(4-cyclohexylphenyl)pyrrolidine-2,5-dione.
| Compound Name | 3-(4-cyclohexylphenyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 82120778 |
| Molecular Formula | C16H19NO2 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | 3-(4-cyclohexylphenyl)pyrrolidine-2,5-dione |
| SMILES | O=C1CC(c2ccc(C3CCCCC3)cc2)C(=O)N1 |
| InChI | InChI=1S/C16H19NO2/c18-15-10-14(16(19)17-15)13-8-6-12(7-9-13)11-4-2-1-3-5-11/h6-9,11,14H,1-5,10H2,(H,17,18,19) |
| InChIKey | MHZGNUDOEZYROQ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|