C14H15NO3 — CID 171098619
3-[4-(2,6-dioxopiperidin-3-yl)phenyl]propanal (PubChem CID 171098619) has the molecular formula C14H15NO3 and a molecular weight of 245.28 g/mol. Its IUPAC name is 3-[4-(2,6-dioxopiperidin-3-yl)phenyl]propanal.
| Compound Name | 3-[4-(2,6-dioxopiperidin-3-yl)phenyl]propanal |
|---|---|
| PubChem CID | 171098619 |
| Molecular Formula | C14H15NO3 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.11 |
| IUPAC Name | 3-[4-(2,6-dioxopiperidin-3-yl)phenyl]propanal |
| SMILES | O=CCCc1ccc(C2CCC(=O)NC2=O)cc1 |
| InChI | InChI=1S/C14H15NO3/c16-9-1-2-10-3-5-11(6-4-10)12-7-8-13(17)15-14(12)18/h3-6,9,12H,1-2,7-8H2,(H,15,17,18) |
| InChIKey | PGUNIQZJRCCAAE-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|