C25H36N2O2 — CID 171406546
3-[4-[2-[1-(cyclohexylmethyl)piperidin-4-yl]ethyl]phenyl]piperidine-2,6-dione (PubChem CID 171406546) has the molecular formula C25H36N2O2 and a molecular weight of 396.58 g/mol. Its IUPAC name is 3-[4-[2-[1-(cyclohexylmethyl)piperidin-4-yl]ethyl]phenyl]piperidine-2,6-dione.
| Compound Name | 3-[4-[2-[1-(cyclohexylmethyl)piperidin-4-yl]ethyl]phenyl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 171406546 |
| Molecular Formula | C25H36N2O2 |
| Molecular Weight | 396.58 g/mol |
| Exact Mass | 396.28 |
| IUPAC Name | 3-[4-[2-[1-(cyclohexylmethyl)piperidin-4-yl]ethyl]phenyl]piperidine-2,6-dione |
| SMILES | O=C1CCC(c2ccc(CCC3CCN(CC4CCCCC4)CC3)cc2)C(=O)N1 |
| InChI | InChI=1S/C25H36N2O2/c28-24-13-12-23(25(29)26-24)22-10-8-19(9-11-22)6-7-20-14-16-27(17-15-20)18-21-4-2-1-3-5-21/h8-11,20-21,23H,1-7,12-18H2,(H,26,28,29) |
| InChIKey | FIOWKJFCDMFNHI-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.58 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|