C26H39ClN4O2 — CID 178081993
3-[4-[4-(3,9-diazaspiro[5.5]undecan-3-ylmethyl)piperidin-1-yl]phenyl]piperidine-2,6-dione;hydrochloride (PubChem CID 178081993) has the molecular formula C26H39ClN4O2 and a molecular weight of 475.08 g/mol. Its IUPAC name is 3-[4-[4-(3,9-diazaspiro[5.5]undecan-3-ylmethyl)piperidin-1-yl]phenyl]piperidine-2,6-dione;hydrochloride.
| Compound Name | 3-[4-[4-(3,9-diazaspiro[5.5]undecan-3-ylmethyl)piperidin-1-yl]phenyl]piperidine-2,6-dione;hydrochloride |
|---|---|
| PubChem CID | 178081993 |
| Molecular Formula | C26H39ClN4O2 |
| Molecular Weight | 475.08 g/mol |
| Exact Mass | 474.28 |
| IUPAC Name | 3-[4-[4-(3,9-diazaspiro[5.5]undecan-3-ylmethyl)piperidin-1-yl]phenyl]piperidine-2,6-dione;hydrochloride |
| SMILES | Cl.O=C1CCC(c2ccc(N3CCC(CN4CCC5(CCNCC5)CC4)CC3)cc2)C(=O)N1 |
| InChI | InChI=1S/C26H38N4O2.ClH/c31-24-6-5-23(25(32)28-24)21-1-3-22(4-2-21)30-15-7-20(8-16-30)19-29-17-11-26(12-18-29)9-13-27-14-10-26;/h1-4,20,23,27H,5-19H2,(H,28,31,32);1H |
| InChIKey | IMNJLWBZTGVMGY-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.08 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|