C32H41N7O3 — CID 166095479
3-[4-[4-[[1-[4-amino-5-methoxy-2-(1-methylpyrazol-4-yl)phenyl]piperidin-4-yl]methyl]piperazin-1-yl]phenyl]piperidine-2,6-dione (PubChem CID 166095479) has the molecular formula C32H41N7O3 and a molecular weight of 571.73 g/mol. Its IUPAC name is 3-[4-[4-[[1-[4-amino-5-methoxy-2-(1-methylpyrazol-4-yl)phenyl]piperidin-4-yl]methyl]piperazin-1-yl]phenyl]piperidine-2,6-dione.
| Compound Name | 3-[4-[4-[[1-[4-amino-5-methoxy-2-(1-methylpyrazol-4-yl)phenyl]piperidin-4-yl]methyl]piperazin-1-yl]phenyl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 166095479 |
| Molecular Formula | C32H41N7O3 |
| Molecular Weight | 571.73 g/mol |
| Exact Mass | 571.33 |
| IUPAC Name | 3-[4-[4-[[1-[4-amino-5-methoxy-2-(1-methylpyrazol-4-yl)phenyl]piperidin-4-yl]methyl]piperazin-1-yl]phenyl]piperidine-2,6-dione |
| SMILES | COc1cc(N2CCC(CN3CCN(c4ccc(C5CCC(=O)NC5=O)cc4)CC3)CC2)c(-c2cnn(C)c2)cc1N |
| InChI | InChI=1S/C32H41N7O3/c1-36-21-24(19-34-36)27-17-28(33)30(42-2)18-29(27)39-11-9-22(10-12-39)20-37-13-15-38(16-14-37)25-5-3-23(4-6-25)26-7-8-31(40)35-32(26)41/h3-6,17-19,21-22,26H,7-16,20,33H2,1-2H3,(H,35,40,41) |
| InChIKey | VPDGFUJQCDHFTF-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 108.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.73 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|