C23H36N6O2 — CID 168838663
2-methoxy-4-[4-[4-(2-methoxyethyl)piperazin-1-yl]piperidin-1-yl]-5-(1-methylpyrazol-4-yl)aniline (PubChem CID 168838663) has the molecular formula C23H36N6O2 and a molecular weight of 428.58 g/mol. Its IUPAC name is 2-methoxy-4-[4-[4-(2-methoxyethyl)piperazin-1-yl]piperidin-1-yl]-5-(1-methylpyrazol-4-yl)aniline.
| Compound Name | 2-methoxy-4-[4-[4-(2-methoxyethyl)piperazin-1-yl]piperidin-1-yl]-5-(1-methylpyrazol-4-yl)aniline |
|---|---|
| PubChem CID | 168838663 |
| Molecular Formula | C23H36N6O2 |
| Molecular Weight | 428.58 g/mol |
| Exact Mass | 428.29 |
| IUPAC Name | 2-methoxy-4-[4-[4-(2-methoxyethyl)piperazin-1-yl]piperidin-1-yl]-5-(1-methylpyrazol-4-yl)aniline |
| SMILES | COCCN1CCN(C2CCN(c3cc(OC)c(N)cc3-c3cnn(C)c3)CC2)CC1 |
| InChI | InChI=1S/C23H36N6O2/c1-26-17-18(16-25-26)20-14-21(24)23(31-3)15-22(20)29-6-4-19(5-7-29)28-10-8-27(9-11-28)12-13-30-2/h14-17,19H,4-13,24H2,1-3H3 |
| InChIKey | SFEJLYLMEDLYPT-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 72.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.58 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|