C18H28ClFN4O — CID 59452960
5-chloro-4-[4-[4-(2-fluoroethyl)piperazin-1-yl]piperidin-1-yl]-2-methoxyaniline (PubChem CID 59452960) has the molecular formula C18H28ClFN4O and a molecular weight of 370.90 g/mol. Its IUPAC name is 5-chloro-4-[4-[4-(2-fluoroethyl)piperazin-1-yl]piperidin-1-yl]-2-methoxyaniline.
| Compound Name | 5-chloro-4-[4-[4-(2-fluoroethyl)piperazin-1-yl]piperidin-1-yl]-2-methoxyaniline |
|---|---|
| PubChem CID | 59452960 |
| Molecular Formula | C18H28ClFN4O |
| Molecular Weight | 370.90 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | 5-chloro-4-[4-[4-(2-fluoroethyl)piperazin-1-yl]piperidin-1-yl]-2-methoxyaniline |
| SMILES | COc1cc(N2CCC(N3CCN(CCF)CC3)CC2)c(Cl)cc1N |
| InChI | InChI=1S/C18H28ClFN4O/c1-25-18-13-17(15(19)12-16(18)21)24-5-2-14(3-6-24)23-10-8-22(7-4-20)9-11-23/h12-14H,2-11,21H2,1H3 |
| InChIKey | ILCKVGQHSPNDBB-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 44.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.90 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|